C12H18N2O4S — CID 22456387
tert-butyl 2-[(4-aminophenyl)sulfonylamino]acetate (PubChem CID 22456387) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is tert-butyl 2-[(4-aminophenyl)sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[(4-aminophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 22456387 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | tert-butyl 2-[(4-aminophenyl)sulfonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c1-12(2,3)18-11(15)8-14-19(16,17)10-6-4-9(13)5-7-10/h4-7,14H,8,13H2,1-3H3 |
| InChIKey | GOJKCECXKSCVAZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|