C18H28BNO6S — CID 20769580
tert-butyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]acetate (PubChem CID 20769580) has the molecular formula C18H28BNO6S and a molecular weight of 397.30 g/mol. Its IUPAC name is tert-butyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 20769580 |
| Molecular Formula | C18H28BNO6S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | tert-butyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNS(=O)(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H28BNO6S/c1-16(2,3)24-15(21)12-20-27(22,23)14-10-8-13(9-11-14)19-25-17(4,5)18(6,7)26-19/h8-11,20H,12H2,1-7H3 |
| InChIKey | MNDIQGVQLYPXNM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|