C31H44B2O8S2 — CID 159025030
CID 159025030 (PubChem CID 159025030) has the molecular formula C31H44B2O8S2 and a molecular weight of 630.44 g/mol.
| Compound Name | CID 159025030 |
|---|---|
| PubChem CID | 159025030 |
| Molecular Formula | C31H44B2O8S2 |
| Molecular Weight | 630.44 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1.COC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1.S=S |
| InChI | InChI=1S/C17H25BO4.C14H19BO4.S2/c1-15(2,3)20-14(19)12-8-10-13(11-9-12)18-21-16(4,5)17(6,7)22-18;1-13(2)14(3,4)19-15(18-13)11-8-6-10(7-9-11)12(16)17-5;1-2/h8-11H,1-7H3;6-9H,1-5H3; |
| InChIKey | JUEGOFOXCGKIQJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|