C17H24BFO4 — CID 167739109
tert-butyl 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 167739109) has the molecular formula C17H24BFO4 and a molecular weight of 322.19 g/mol. Its IUPAC name is tert-butyl 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | tert-butyl 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 167739109 |
| Molecular Formula | C17H24BFO4 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(F)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H24BFO4/c1-15(2,3)21-14(20)11-8-12(10-13(19)9-11)18-22-16(4,5)17(6,7)23-18/h8-10H,1-7H3 |
| InChIKey | PIAUSAOCIOGWOM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|