C19H24BFO4 — CID 167734458
tert-butyl 3-ethynyl-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 167734458) has the molecular formula C19H24BFO4 and a molecular weight of 346.21 g/mol. Its IUPAC name is tert-butyl 3-ethynyl-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | tert-butyl 3-ethynyl-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 167734458 |
| Molecular Formula | C19H24BFO4 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | tert-butyl 3-ethynyl-4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | C#Cc1cc(C(=O)OC(C)(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C19H24BFO4/c1-9-12-10-13(16(22)23-17(2,3)4)11-14(15(12)21)20-24-18(5,6)19(7,8)25-20/h1,10-11H,2-8H3 |
| InChIKey | JQCHSOLRGPZQKK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|