C19H27BO6 — CID 154704853
3-O-tert-butyl 1-O-methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxylate (PubChem CID 154704853) has the molecular formula C19H27BO6 and a molecular weight of 362.23 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 154704853 |
| Molecular Formula | C19H27BO6 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H27BO6/c1-17(2,3)24-16(22)13-9-12(15(21)23-8)10-14(11-13)20-25-18(4,5)19(6,7)26-20/h9-11H,1-8H3 |
| InChIKey | SVXFJNMGHBTXKS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|