C18H27BO5 — CID 153444479
tert-butyl 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 153444479) has the molecular formula C18H27BO5 and a molecular weight of 334.22 g/mol. Its IUPAC name is tert-butyl 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | tert-butyl 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 153444479 |
| Molecular Formula | C18H27BO5 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | tert-butyl 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27BO5/c1-16(2,3)22-15(20)13-10-9-12(11-14(13)21-8)19-23-17(4,5)18(6,7)24-19/h9-11H,1-8H3 |
| InChIKey | QCNNSISXLBCAMI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|