C22H35BN2O7S — CID 154402454
tert-butyl 3-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]-3-methylazetidine-1-carboxylate (PubChem CID 154402454) has the molecular formula C22H35BN2O7S and a molecular weight of 482.41 g/mol. Its IUPAC name is tert-butyl 3-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]-3-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 154402454 |
| Molecular Formula | C22H35BN2O7S |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | tert-butyl 3-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]-3-methylazetidine-1-carboxylate |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1S(=O)(=O)NC1(C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H35BN2O7S/c1-19(2,3)30-18(26)25-13-22(8,14-25)24-33(27,28)17-12-15(10-11-16(17)29-9)23-31-20(4,5)21(6,7)32-23/h10-12,24H,13-14H2,1-9H3 |
| InChIKey | AWZPHNKZMHEGMX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|