C23H37BN2O7S — CID 131745068
tert-butyl 4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 131745068) has the molecular formula C23H37BN2O7S and a molecular weight of 496.44 g/mol. Its IUPAC name is tert-butyl 4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131745068 |
| Molecular Formula | C23H37BN2O7S |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | tert-butyl 4-[[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1S(=O)(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H37BN2O7S/c1-21(2,3)31-20(27)26-13-11-17(12-14-26)25-34(28,29)19-10-9-16(15-18(19)30-8)24-32-22(4,5)23(6,7)33-24/h9-10,15,17,25H,11-14H2,1-8H3 |
| InChIKey | WHWJYOLNCMUEIZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|