C16H25N3O4S — CID 53256090
tert-butyl 4-[(4-aminophenyl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 53256090) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is tert-butyl 4-[(4-aminophenyl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-aminophenyl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 53256090 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | tert-butyl 4-[(4-aminophenyl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NS(=O)(=O)c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C16H25N3O4S/c1-16(2,3)23-15(20)19-10-8-13(9-11-19)18-24(21,22)14-6-4-12(17)5-7-14/h4-7,13,18H,8-11,17H2,1-3H3 |
| InChIKey | ZKDNDLNAFHXFJU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|