C16H24ClN3O5S — CID 143568268
tert-butyl 4-[(3-amino-6-chloro-2-hydroxyphenyl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 143568268) has the molecular formula C16H24ClN3O5S and a molecular weight of 405.90 g/mol. Its IUPAC name is tert-butyl 4-[(3-amino-6-chloro-2-hydroxyphenyl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-amino-6-chloro-2-hydroxyphenyl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143568268 |
| Molecular Formula | C16H24ClN3O5S |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | tert-butyl 4-[(3-amino-6-chloro-2-hydroxyphenyl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NS(=O)(=O)c2c(Cl)ccc(N)c2O)CC1 |
| InChI | InChI=1S/C16H24ClN3O5S/c1-16(2,3)25-15(22)20-8-6-10(7-9-20)19-26(23,24)14-11(17)4-5-12(18)13(14)21/h4-5,10,19,21H,6-9,18H2,1-3H3 |
| InChIKey | QUYCVTDJSVJNFD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|