C16H22Cl2N2O4S — CID 24953157
tert-butyl 4-[(2,3-dichlorophenyl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 24953157) has the molecular formula C16H22Cl2N2O4S and a molecular weight of 409.34 g/mol. Its IUPAC name is tert-butyl 4-[(2,3-dichlorophenyl)sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2,3-dichlorophenyl)sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24953157 |
| Molecular Formula | C16H22Cl2N2O4S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | tert-butyl 4-[(2,3-dichlorophenyl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NS(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C16H22Cl2N2O4S/c1-16(2,3)24-15(21)20-9-7-11(8-10-20)19-25(22,23)13-6-4-5-12(17)14(13)18/h4-6,11,19H,7-10H2,1-3H3 |
| InChIKey | FBIATNOUFDEXJY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |