C15H19Cl2NO3 — CID 69451031
tert-butyl 3-(2,3-dichlorophenoxy)pyrrolidine-1-carboxylate (PubChem CID 69451031) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is tert-butyl 3-(2,3-dichlorophenoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2,3-dichlorophenoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69451031 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | tert-butyl 3-(2,3-dichlorophenoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C15H19Cl2NO3/c1-15(2,3)21-14(19)18-8-7-10(9-18)20-12-6-4-5-11(16)13(12)17/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | AQBWGKQWWGLKPS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |