C20H21N5O3 — CID 168608751
tert-butyl 3-[2-(1,2,2-tricyanoethenylamino)phenoxy]pyrrolidine-1-carboxylate (PubChem CID 168608751) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is tert-butyl 3-[2-(1,2,2-tricyanoethenylamino)phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(1,2,2-tricyanoethenylamino)phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168608751 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | tert-butyl 3-[2-(1,2,2-tricyanoethenylamino)phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccccc2NC(C#N)=C(C#N)C#N)C1 |
| InChI | InChI=1S/C20H21N5O3/c1-20(2,3)28-19(26)25-9-8-15(13-25)27-18-7-5-4-6-16(18)24-17(12-23)14(10-21)11-22/h4-7,15,24H,8-9,13H2,1-3H3 |
| InChIKey | ACKOVBINXNVFNM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 122.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|