C22H28N2O7 — CID 168539085
tert-butyl 3-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenoxy]pyrrolidine-1-carboxylate (PubChem CID 168539085) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is tert-butyl 3-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168539085 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | tert-butyl 3-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccccc2NC=C2C(=O)OC(C)(C)OC2=O)C1 |
| InChI | InChI=1S/C22H28N2O7/c1-21(2,3)31-20(27)24-11-10-14(13-24)28-17-9-7-6-8-16(17)23-12-15-18(25)29-22(4,5)30-19(15)26/h6-9,12,14,23H,10-11,13H2,1-5H3 |
| InChIKey | CXRKKRPFVRINHE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|