C18H26ClFN2O4 — CID 168639142
tert-butyl 3-[2-[(3-chloro-2-hydroxypropyl)amino]-4-fluorophenoxy]pyrrolidine-1-carboxylate (PubChem CID 168639142) has the molecular formula C18H26ClFN2O4 and a molecular weight of 388.87 g/mol. Its IUPAC name is tert-butyl 3-[2-[(3-chloro-2-hydroxypropyl)amino]-4-fluorophenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[(3-chloro-2-hydroxypropyl)amino]-4-fluorophenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168639142 |
| Molecular Formula | C18H26ClFN2O4 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | tert-butyl 3-[2-[(3-chloro-2-hydroxypropyl)amino]-4-fluorophenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(F)cc2NCC(O)CCl)C1 |
| InChI | InChI=1S/C18H26ClFN2O4/c1-18(2,3)26-17(24)22-7-6-14(11-22)25-16-5-4-12(20)8-15(16)21-10-13(23)9-19/h4-5,8,13-14,21,23H,6-7,9-11H2,1-3H3 |
| InChIKey | KXHLDJFOOOXZQN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|