C22H28FN3O6 — CID 168559188
tert-butyl 4-[4-fluoro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]piperidine-1-carboxylate (PubChem CID 168559188) has the molecular formula C22H28FN3O6 and a molecular weight of 449.48 g/mol. Its IUPAC name is tert-butyl 4-[4-fluoro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-fluoro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168559188 |
| Molecular Formula | C22H28FN3O6 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | tert-butyl 4-[4-fluoro-2-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(F)cc2NC2=CC(=O)N(CCO)C2=O)CC1 |
| InChI | InChI=1S/C22H28FN3O6/c1-22(2,3)32-21(30)25-8-6-15(7-9-25)31-18-5-4-14(23)12-16(18)24-17-13-19(28)26(10-11-27)20(17)29/h4-5,12-13,15,24,27H,6-11H2,1-3H3 |
| InChIKey | GDCZYKHKINKPHI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|