C19H26FNO5 — CID 67528811
tert-butyl 4-[2-(acetyloxymethyl)-4-fluorophenoxy]piperidine-1-carboxylate (PubChem CID 67528811) has the molecular formula C19H26FNO5 and a molecular weight of 367.42 g/mol. Its IUPAC name is tert-butyl 4-[2-(acetyloxymethyl)-4-fluorophenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(acetyloxymethyl)-4-fluorophenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67528811 |
| Molecular Formula | C19H26FNO5 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | tert-butyl 4-[2-(acetyloxymethyl)-4-fluorophenoxy]piperidine-1-carboxylate |
| SMILES | CC(=O)OCc1cc(F)ccc1OC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H26FNO5/c1-13(22)24-12-14-11-15(20)5-6-17(14)25-16-7-9-21(10-8-16)18(23)26-19(2,3)4/h5-6,11,16H,7-10,12H2,1-4H3 |
| InChIKey | RVLZZAHAVNGNJI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |