C23H29NO4 — CID 67313124
tert-butyl 4-(2-phenylmethoxyphenoxy)piperidine-1-carboxylate (PubChem CID 67313124) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is tert-butyl 4-(2-phenylmethoxyphenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-phenylmethoxyphenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67313124 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl 4-(2-phenylmethoxyphenoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccccc2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29NO4/c1-23(2,3)28-22(25)24-15-13-19(14-16-24)27-21-12-8-7-11-20(21)26-17-18-9-5-4-6-10-18/h4-12,19H,13-17H2,1-3H3 |
| InChIKey | SQXUOIFFYJZOOL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |