C22H32N2O5 — CID 167488852
benzyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxypiperidine-1-carboxylate (PubChem CID 167488852) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is benzyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxypiperidine-1-carboxylate.
| Compound Name | benzyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167488852 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | benzyl 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OC2CCN(C(=O)OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H32N2O5/c1-22(2,3)29-21(26)24-14-11-19(15-24)28-18-9-12-23(13-10-18)20(25)27-16-17-7-5-4-6-8-17/h4-8,18-19H,9-16H2,1-3H3 |
| InChIKey | UDYYFLBKWZDSJD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |