C20H29NO5 — CID 68919124
benzyl 4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]piperidine-1-carboxylate (PubChem CID 68919124) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is benzyl 4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68919124 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | benzyl 4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)CCOC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H29NO5/c1-20(2,3)26-18(22)11-14-24-17-9-12-21(13-10-17)19(23)25-15-16-7-5-4-6-8-16/h4-8,17H,9-15H2,1-3H3 |
| InChIKey | UVFQHMNRRVLWGO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |