C25H39NO6 — CID 172575946
benzyl 4-hydroxy-4-[[7-[(2-methylpropan-2-yl)oxy]-7-oxoheptoxy]methyl]piperidine-1-carboxylate (PubChem CID 172575946) has the molecular formula C25H39NO6 and a molecular weight of 449.59 g/mol. Its IUPAC name is benzyl 4-hydroxy-4-[[7-[(2-methylpropan-2-yl)oxy]-7-oxoheptoxy]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-hydroxy-4-[[7-[(2-methylpropan-2-yl)oxy]-7-oxoheptoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172575946 |
| Molecular Formula | C25H39NO6 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | benzyl 4-hydroxy-4-[[7-[(2-methylpropan-2-yl)oxy]-7-oxoheptoxy]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)CCCCCCOCC1(O)CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H39NO6/c1-24(2,3)32-22(27)13-9-4-5-10-18-30-20-25(29)14-16-26(17-15-25)23(28)31-19-21-11-7-6-8-12-21/h6-8,11-12,29H,4-5,9-10,13-20H2,1-3H3 |
| InChIKey | IEQPBYMOZKDCJU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|