C26H42N2O5 — CID 163463594
tert-butyl 5-[2-[4-(4-oxo-4-phenylmethoxybutyl)piperazin-1-yl]ethoxy]pentanoate (PubChem CID 163463594) has the molecular formula C26H42N2O5 and a molecular weight of 462.63 g/mol. Its IUPAC name is tert-butyl 5-[2-[4-(4-oxo-4-phenylmethoxybutyl)piperazin-1-yl]ethoxy]pentanoate.
| Compound Name | tert-butyl 5-[2-[4-(4-oxo-4-phenylmethoxybutyl)piperazin-1-yl]ethoxy]pentanoate |
|---|---|
| PubChem CID | 163463594 |
| Molecular Formula | C26H42N2O5 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | tert-butyl 5-[2-[4-(4-oxo-4-phenylmethoxybutyl)piperazin-1-yl]ethoxy]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCCOCCN1CCN(CCCC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H42N2O5/c1-26(2,3)33-25(30)12-7-8-20-31-21-19-28-17-15-27(16-18-28)14-9-13-24(29)32-22-23-10-5-4-6-11-23/h4-6,10-11H,7-9,12-22H2,1-3H3 |
| InChIKey | ABGQXZGFMVDPKQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|