C26H37N4O8Tm-3 — CID 58455082
2-[4,7-bis(carboxylatomethyl)-10-(5-oxo-5-phenylmethoxypentyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;thulium (PubChem CID 58455082) has the molecular formula C26H37N4O8Tm-3 and a molecular weight of 702.54 g/mol. Its IUPAC name is 2-[4,7-bis(carboxylatomethyl)-10-(5-oxo-5-phenylmethoxypentyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;thulium.
| Compound Name | 2-[4,7-bis(carboxylatomethyl)-10-(5-oxo-5-phenylmethoxypentyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;thulium |
|---|---|
| PubChem CID | 58455082 |
| Molecular Formula | C26H37N4O8Tm-3 |
| Molecular Weight | 702.54 g/mol |
| Exact Mass | 702.20 |
| IUPAC Name | 2-[4,7-bis(carboxylatomethyl)-10-(5-oxo-5-phenylmethoxypentyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;thulium |
| SMILES | O=C([O-])CN1CCN(CCCCC(=O)OCc2ccccc2)CCN(CC(=O)[O-])CCN(CC(=O)[O-])CC1.[Tm] |
| InChI | InChI=1S/C26H40N4O8.Tm/c31-23(32)18-28-12-10-27(9-5-4-8-26(37)38-21-22-6-2-1-3-7-22)11-13-29(19-24(33)34)15-17-30(16-14-28)20-25(35)36;/h1-3,6-7H,4-5,8-21H2,(H,31,32)(H,33,34)(H,35,36);/p-3 |
| InChIKey | KRKHKWSBNNJEPA-UHFFFAOYSA-K |
| XLogP | -3.63 |
| TPSA | 159.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.54 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|