C23H28N2O4 — CID 101385594
benzyl 2-[4-(2-oxo-2-phenylmethoxyethyl)-1,4-diazepan-1-yl]acetate (PubChem CID 101385594) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is benzyl 2-[4-(2-oxo-2-phenylmethoxyethyl)-1,4-diazepan-1-yl]acetate.
| Compound Name | benzyl 2-[4-(2-oxo-2-phenylmethoxyethyl)-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 101385594 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | benzyl 2-[4-(2-oxo-2-phenylmethoxyethyl)-1,4-diazepan-1-yl]acetate |
| SMILES | O=C(CN1CCCN(CC(=O)OCc2ccccc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O4/c26-22(28-18-20-8-3-1-4-9-20)16-24-12-7-13-25(15-14-24)17-23(27)29-19-21-10-5-2-6-11-21/h1-6,8-11H,7,12-19H2 |
| InChIKey | JJIBRHPFAAQNSO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |