C21H35N3O5 — CID 177188457
benzyl 2-(1,7,13-trioxa-4,10,16-triazacyclooctadec-4-yl)acetate (PubChem CID 177188457) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is benzyl 2-(1,7,13-trioxa-4,10,16-triazacyclooctadec-4-yl)acetate.
| Compound Name | benzyl 2-(1,7,13-trioxa-4,10,16-triazacyclooctadec-4-yl)acetate |
|---|---|
| PubChem CID | 177188457 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | benzyl 2-(1,7,13-trioxa-4,10,16-triazacyclooctadec-4-yl)acetate |
| SMILES | O=C(CN1CCOCCNCCOCCNCCOCC1)OCc1ccccc1 |
| InChI | InChI=1S/C21H35N3O5/c25-21(29-19-20-4-2-1-3-5-20)18-24-10-16-27-14-8-22-6-12-26-13-7-23-9-15-28-17-11-24/h1-5,22-23H,6-19H2 |
| InChIKey | MBKIIPRIFKGGQV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |