C18H25NO5 — CID 147392952
(2R)-5-morpholin-4-yl-2-(2-oxo-2-phenylmethoxyethyl)pentanoic acid (PubChem CID 147392952) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2R)-5-morpholin-4-yl-2-(2-oxo-2-phenylmethoxyethyl)pentanoic acid.
| Compound Name | (2R)-5-morpholin-4-yl-2-(2-oxo-2-phenylmethoxyethyl)pentanoic acid |
|---|---|
| PubChem CID | 147392952 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (2R)-5-morpholin-4-yl-2-(2-oxo-2-phenylmethoxyethyl)pentanoic acid |
| SMILES | O=C(C[C@@H](CCCN1CCOCC1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25NO5/c20-17(24-14-15-5-2-1-3-6-15)13-16(18(21)22)7-4-8-19-9-11-23-12-10-19/h1-3,5-6,16H,4,7-14H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | DNFYZSZOVQCJDK-MRXNPFEDSA-N |
| XLogP | 1.93 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |