About 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride
2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride (PubChem CID 23622530) has the molecular formula C14H22ClNO4
and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride |
| PubChem CID | 23622530 |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride |
| SMILES | Cl.O.O=C(Cc1ccccc1)OCCN1CCOCC1 |
| InChI | InChI=1S/C14H19NO3.ClH.H2O/c16-14(12-13-4-2-1-3-5-13)18-11-8-15-6-9-17-10-7-15;;/h1-5H,6-12H2;1H;1H2 |
| InChIKey | MKAXKDWEHPBRKD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride?
The IUPAC name of 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride (CID 23622530) is 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride.
What is the SMILES notation for 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride?
The canonical SMILES for 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride is Cl.O.O=C(Cc1ccccc1)OCCN1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride?
The InChIKey is MKAXKDWEHPBRKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3.ClH.H2O/c16-14(12-13-4-2-1-3-5-13)18-11-8-15-6-9-17-10-7-15;;/h1-5H,6-12H2;1H;1H2.
What are the key properties of 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride?
2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride has a molecular weight of 303.79 g/mol, XLogP of 0.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 2-phenylacetate;hydrate;hydrochloride is sourced from PubChem (CID 23622530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).