About S-(morpholin-4-ylmethyl) 2-phenylethanethioate
S-(morpholin-4-ylmethyl) 2-phenylethanethioate (PubChem CID 24975270) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is S-(morpholin-4-ylmethyl) 2-phenylethanethioate.
Molecular Properties
| Compound Name | S-(morpholin-4-ylmethyl) 2-phenylethanethioate |
| PubChem CID | 24975270 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | S-(morpholin-4-ylmethyl) 2-phenylethanethioate |
| SMILES | O=C(Cc1ccccc1)SCN1CCOCC1 |
| InChI | InChI=1S/C13H17NO2S/c15-13(10-12-4-2-1-3-5-12)17-11-14-6-8-16-9-7-14/h1-5H,6-11H2 |
| InChIKey | MFNWXPDJPKYWGL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(morpholin-4-ylmethyl) 2-phenylethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(morpholin-4-ylmethyl) 2-phenylethanethioate?
The IUPAC name of S-(morpholin-4-ylmethyl) 2-phenylethanethioate (CID 24975270) is S-(morpholin-4-ylmethyl) 2-phenylethanethioate.
What is the SMILES notation for S-(morpholin-4-ylmethyl) 2-phenylethanethioate?
The canonical SMILES for S-(morpholin-4-ylmethyl) 2-phenylethanethioate is O=C(Cc1ccccc1)SCN1CCOCC1.
What is the InChIKey of S-(morpholin-4-ylmethyl) 2-phenylethanethioate?
The InChIKey is MFNWXPDJPKYWGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2S/c15-13(10-12-4-2-1-3-5-12)17-11-14-6-8-16-9-7-14/h1-5H,6-11H2.
What are the key properties of S-(morpholin-4-ylmethyl) 2-phenylethanethioate?
S-(morpholin-4-ylmethyl) 2-phenylethanethioate has a molecular weight of 251.35 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(morpholin-4-ylmethyl) 2-phenylethanethioate is sourced from PubChem (CID 24975270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).