C12H15LiNO3 — CID 131887032
CID 131887032 (PubChem CID 131887032) has the molecular formula C12H15LiNO3 and a molecular weight of 228.20 g/mol.
| Compound Name | CID 131887032 |
|---|---|
| PubChem CID | 131887032 |
| Molecular Formula | C12H15LiNO3 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccccc1CN1CCOCC1.[Li] |
| InChI | InChI=1S/C12H15NO3.Li/c14-12(15)11-4-2-1-3-10(11)9-13-5-7-16-8-6-13;/h1-4H,5-9H2,(H,14,15); |
| InChIKey | MTBHWJHBEHWKOL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |