C18H26N2O4 — CID 120614385
(2S)-2-[[2-(morpholin-4-ylmethyl)benzoyl]amino]hexanoic acid (PubChem CID 120614385) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2S)-2-[[2-(morpholin-4-ylmethyl)benzoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(morpholin-4-ylmethyl)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120614385 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (2S)-2-[[2-(morpholin-4-ylmethyl)benzoyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1ccccc1CN1CCOCC1)C(=O)O |
| InChI | InChI=1S/C18H26N2O4/c1-2-3-8-16(18(22)23)19-17(21)15-7-5-4-6-14(15)13-20-9-11-24-12-10-20/h4-7,16H,2-3,8-13H2,1H3,(H,19,21)(H,22,23)/t16-/m0/s1 |
| InChIKey | SAWAHBISYXXCAG-INIZCTEOSA-N |
| XLogP | 1.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |