C22H36Cl2N2O3 — CID 142749275
2-[1-[(2-morpholin-4-ylphenyl)methyl]piperidin-4-yl]hexanoic acid;dihydrochloride (PubChem CID 142749275) has the molecular formula C22H36Cl2N2O3 and a molecular weight of 447.45 g/mol. Its IUPAC name is 2-[1-[(2-morpholin-4-ylphenyl)methyl]piperidin-4-yl]hexanoic acid;dihydrochloride.
| Compound Name | 2-[1-[(2-morpholin-4-ylphenyl)methyl]piperidin-4-yl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 142749275 |
| Molecular Formula | C22H36Cl2N2O3 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-[1-[(2-morpholin-4-ylphenyl)methyl]piperidin-4-yl]hexanoic acid;dihydrochloride |
| SMILES | CCCCC(C(=O)O)C1CCN(Cc2ccccc2N2CCOCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H34N2O3.2ClH/c1-2-3-7-20(22(25)26)18-9-11-23(12-10-18)17-19-6-4-5-8-21(19)24-13-15-27-16-14-24;;/h4-6,8,18,20H,2-3,7,9-17H2,1H3,(H,25,26);2*1H |
| InChIKey | HXDWUBRJGNSJFK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |