C16H23Cl2NO2 — CID 142749278
2-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]hexanoic acid;hydrochloride (PubChem CID 142749278) has the molecular formula C16H23Cl2NO2 and a molecular weight of 332.27 g/mol. Its IUPAC name is 2-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]hexanoic acid;hydrochloride.
| Compound Name | 2-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 142749278 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]hexanoic acid;hydrochloride |
| SMILES | CCCCC(C(=O)O)[C@@H]1CCN(c2ccc(Cl)cc2)C1.Cl |
| InChI | InChI=1S/C16H22ClNO2.ClH/c1-2-3-4-15(16(19)20)12-9-10-18(11-12)14-7-5-13(17)6-8-14;/h5-8,12,15H,2-4,9-11H2,1H3,(H,19,20);1H/t12-,15?;/m1./s1 |
| InChIKey | IYICKQCYTNUCIU-DJDUHJHYSA-N |
| XLogP | 4.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |