C16H24BClN2O4 — CID 161052174
[(5S)-5-amino-5-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]pentyl]boronic acid;carbon dioxide (PubChem CID 161052174) has the molecular formula C16H24BClN2O4 and a molecular weight of 354.64 g/mol. Its IUPAC name is [(5S)-5-amino-5-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]pentyl]boronic acid;carbon dioxide.
| Compound Name | [(5S)-5-amino-5-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]pentyl]boronic acid;carbon dioxide |
|---|---|
| PubChem CID | 161052174 |
| Molecular Formula | C16H24BClN2O4 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(5S)-5-amino-5-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]pentyl]boronic acid;carbon dioxide |
| SMILES | N[C@@H](CCCCB(O)O)[C@H]1CCN(c2ccc(Cl)cc2)C1.O=C=O |
| InChI | InChI=1S/C15H24BClN2O2.CO2/c17-13-4-6-14(7-5-13)19-10-8-12(11-19)15(18)3-1-2-9-16(20)21;2-1-3/h4-7,12,15,20-21H,1-3,8-11,18H2;/t12-,15-;/m0./s1 |
| InChIKey | UCGYMHTXARUYBX-NXCSSKFKSA-N |
| XLogP | 1.55 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|