C16H24BClN2O4 — CID 66833149
2-amino-6-borono-2-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]hexanoic acid (PubChem CID 66833149) has the molecular formula C16H24BClN2O4 and a molecular weight of 354.64 g/mol. Its IUPAC name is 2-amino-6-borono-2-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 66833149 |
| Molecular Formula | C16H24BClN2O4 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-amino-6-borono-2-[(3S)-1-(4-chlorophenyl)pyrrolidin-3-yl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)[C@H]1CCN(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H24BClN2O4/c18-13-3-5-14(6-4-13)20-10-7-12(11-20)16(19,15(21)22)8-1-2-9-17(23)24/h3-6,12,23-24H,1-2,7-11,19H2,(H,21,22)/t12-,16?/m0/s1 |
| InChIKey | OHYYFNCNIUAMJG-HKALDPMFSA-N |
| XLogP | 1.59 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|