C20H32BN3O5 — CID 151339451
2-amino-6-borono-2-[1-(3-oxo-5,6,7,8-tetrahydro-2H-isoquinolin-5-yl)piperidin-4-yl]hexanoic acid (PubChem CID 151339451) has the molecular formula C20H32BN3O5 and a molecular weight of 405.30 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-(3-oxo-5,6,7,8-tetrahydro-2H-isoquinolin-5-yl)piperidin-4-yl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[1-(3-oxo-5,6,7,8-tetrahydro-2H-isoquinolin-5-yl)piperidin-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 151339451 |
| Molecular Formula | C20H32BN3O5 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-amino-6-borono-2-[1-(3-oxo-5,6,7,8-tetrahydro-2H-isoquinolin-5-yl)piperidin-4-yl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CCN(C2CCCc3c[nH]c(=O)cc32)CC1 |
| InChI | InChI=1S/C20H32BN3O5/c22-20(19(26)27,8-1-2-9-21(28)29)15-6-10-24(11-7-15)17-5-3-4-14-13-23-18(25)12-16(14)17/h12-13,15,17,28-29H,1-11,22H2,(H,23,25)(H,26,27) |
| InChIKey | OKDPSTMTBQQLES-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|