C20H31BN2O4 — CID 151677191
2-amino-6-borono-2-[1-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrrolidin-3-yl]hexanoic acid (PubChem CID 151677191) has the molecular formula C20H31BN2O4 and a molecular weight of 374.29 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrrolidin-3-yl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[1-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrrolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 151677191 |
| Molecular Formula | C20H31BN2O4 |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2-amino-6-borono-2-[1-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrrolidin-3-yl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CCN(C2CCc3ccccc3C2)C1 |
| InChI | InChI=1S/C20H31BN2O4/c22-20(19(24)25,10-3-4-11-21(26)27)17-9-12-23(14-17)18-8-7-15-5-1-2-6-16(15)13-18/h1-2,5-6,17-18,26-27H,3-4,7-14,22H2,(H,24,25) |
| InChIKey | QZTQLIKUZOCOAP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|