C18H28BCl2F3N2O4 — CID 67451952
2-amino-6-borono-2-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]hexanoic acid;dihydrochloride (PubChem CID 67451952) has the molecular formula C18H28BCl2F3N2O4 and a molecular weight of 475.14 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]hexanoic acid;dihydrochloride.
| Compound Name | 2-amino-6-borono-2-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 67451952 |
| Molecular Formula | C18H28BCl2F3N2O4 |
| Molecular Weight | 475.14 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-amino-6-borono-2-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-yl]hexanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(CCCCB(O)O)(C(=O)O)C1CCN(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H26BF3N2O4.2ClH/c20-18(21,22)14-5-3-13(4-6-14)11-24-10-7-15(12-24)17(23,16(25)26)8-1-2-9-19(27)28;;/h3-6,15,27-28H,1-2,7-12,23H2,(H,25,26);2*1H |
| InChIKey | OAMYXUSAGOVNOY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|