C18H31BCl2N2O4 — CID 66833018
2-amino-6-borono-2-[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]hexanoic acid;dihydrochloride (PubChem CID 66833018) has the molecular formula C18H31BCl2N2O4 and a molecular weight of 421.17 g/mol. Its IUPAC name is 2-amino-6-borono-2-[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]hexanoic acid;dihydrochloride.
| Compound Name | 2-amino-6-borono-2-[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 66833018 |
| Molecular Formula | C18H31BCl2N2O4 |
| Molecular Weight | 421.17 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-amino-6-borono-2-[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]hexanoic acid;dihydrochloride |
| SMILES | Cc1ccc(CN2CC[C@@H](C(N)(CCCCB(O)O)C(=O)O)C2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H29BN2O4.2ClH/c1-14-4-6-15(7-5-14)12-21-11-8-16(13-21)18(20,17(22)23)9-2-3-10-19(24)25;;/h4-7,16,24-25H,2-3,8-13,20H2,1H3,(H,22,23);2*1H/t16-,18?;;/m1../s1 |
| InChIKey | SIYFJSOCJNNXHE-HCLBTYMISA-N |
| XLogP | 2.09 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|