C24H33BN2O4 — CID 78109867
2-amino-6-borono-2-[3-[(4-phenylphenyl)methylamino]cyclopentyl]hexanoic acid (PubChem CID 78109867) has the molecular formula C24H33BN2O4 and a molecular weight of 424.35 g/mol. Its IUPAC name is 2-amino-6-borono-2-[3-[(4-phenylphenyl)methylamino]cyclopentyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[3-[(4-phenylphenyl)methylamino]cyclopentyl]hexanoic acid |
|---|---|
| PubChem CID | 78109867 |
| Molecular Formula | C24H33BN2O4 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2-amino-6-borono-2-[3-[(4-phenylphenyl)methylamino]cyclopentyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CCC(NCc2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C24H33BN2O4/c26-24(23(28)29,14-4-5-15-25(30)31)21-12-13-22(16-21)27-17-18-8-10-20(11-9-18)19-6-2-1-3-7-19/h1-3,6-11,21-22,27,30-31H,4-5,12-17,26H2,(H,28,29) |
| InChIKey | RIGSCJSOCYHRLO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|