C21H35BN2O4 — CID 174692427
2-amino-6-borono-2-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]hexanoic acid (PubChem CID 174692427) has the molecular formula C21H35BN2O4 and a molecular weight of 390.33 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 174692427 |
| Molecular Formula | C21H35BN2O4 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 2-amino-6-borono-2-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(CCN1CCC(CCc2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C21H35BN2O4/c23-21(20(25)26,12-4-5-14-22(27)28)13-17-24-15-10-19(11-16-24)9-8-18-6-2-1-3-7-18/h1-3,6-7,19,27-28H,4-5,8-17,23H2,(H,25,26) |
| InChIKey | NEDGTZDDJDCNCD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|