C9H21BClNO5 — CID 87173227
2-amino-6-borono-2-(3-hydroxypropyl)hexanoic acid;hydrochloride (PubChem CID 87173227) has the molecular formula C9H21BClNO5 and a molecular weight of 269.53 g/mol. Its IUPAC name is 2-amino-6-borono-2-(3-hydroxypropyl)hexanoic acid;hydrochloride.
| Compound Name | 2-amino-6-borono-2-(3-hydroxypropyl)hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87173227 |
| Molecular Formula | C9H21BClNO5 |
| Molecular Weight | 269.53 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-amino-6-borono-2-(3-hydroxypropyl)hexanoic acid;hydrochloride |
| SMILES | Cl.NC(CCCO)(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C9H20BNO5.ClH/c11-9(8(13)14,5-3-7-12)4-1-2-6-10(15)16;/h12,15-16H,1-7,11H2,(H,13,14);1H |
| InChIKey | RVKSKCKDHSXRTI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.53 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|