C12H27BN2O4 — CID 78110000
2-amino-6-borono-2-[2-[methyl(propyl)amino]ethyl]hexanoic acid (PubChem CID 78110000) has the molecular formula C12H27BN2O4 and a molecular weight of 274.17 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-[methyl(propyl)amino]ethyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[2-[methyl(propyl)amino]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 78110000 |
| Molecular Formula | C12H27BN2O4 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 2-amino-6-borono-2-[2-[methyl(propyl)amino]ethyl]hexanoic acid |
| SMILES | CCCN(C)CCC(N)(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C12H27BN2O4/c1-3-9-15(2)10-7-12(14,11(16)17)6-4-5-8-13(18)19/h18-19H,3-10,14H2,1-2H3,(H,16,17) |
| InChIKey | PZLAQLABOPNYDA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|