C9H19BN2O5 — CID 162251924
2-amino-2-(3-amino-3-oxopropyl)-6-boronohexanoic acid (PubChem CID 162251924) has the molecular formula C9H19BN2O5 and a molecular weight of 246.07 g/mol. Its IUPAC name is 2-amino-2-(3-amino-3-oxopropyl)-6-boronohexanoic acid.
| Compound Name | 2-amino-2-(3-amino-3-oxopropyl)-6-boronohexanoic acid |
|---|---|
| PubChem CID | 162251924 |
| Molecular Formula | C9H19BN2O5 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-amino-2-(3-amino-3-oxopropyl)-6-boronohexanoic acid |
| SMILES | NC(=O)CCC(N)(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C9H19BN2O5/c11-7(13)3-5-9(12,8(14)15)4-1-2-6-10(16)17/h16-17H,1-6,12H2,(H2,11,13)(H,14,15) |
| InChIKey | ZYCHNTIZPXSHGR-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|