C8H20BN3O5S — CID 145113733
2-amino-6-borono-2-[2-(sulfinamoylamino)ethyl]hexanoic acid (PubChem CID 145113733) has the molecular formula C8H20BN3O5S and a molecular weight of 281.14 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-(sulfinamoylamino)ethyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[2-(sulfinamoylamino)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 145113733 |
| Molecular Formula | C8H20BN3O5S |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-amino-6-borono-2-[2-(sulfinamoylamino)ethyl]hexanoic acid |
| SMILES | NS(=O)NCCC(N)(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C8H20BN3O5S/c10-8(7(13)14,4-6-12-18(11)17)3-1-2-5-9(15)16/h12,15-16H,1-6,10-11H2,(H,13,14) |
| InChIKey | AQCWIEOSEAEIIV-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|