C16H27BN2O5 — CID 145219561
2-amino-6-borono-2-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]hexanoic acid (PubChem CID 145219561) has the molecular formula C16H27BN2O5 and a molecular weight of 338.21 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 145219561 |
| Molecular Formula | C16H27BN2O5 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-amino-6-borono-2-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(CCNCC(O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H27BN2O5/c18-16(15(21)22,8-4-5-10-17(23)24)9-11-19-12-14(20)13-6-2-1-3-7-13/h1-3,6-7,14,19-20,23-24H,4-5,8-12,18H2,(H,21,22) |
| InChIKey | HCQZKMALHJWBLO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|