C10H23BClNO4 — CID 87173180
2-amino-6-borono-2-(2-methylpropyl)hexanoic acid;hydrochloride (PubChem CID 87173180) has the molecular formula C10H23BClNO4 and a molecular weight of 267.56 g/mol. Its IUPAC name is 2-amino-6-borono-2-(2-methylpropyl)hexanoic acid;hydrochloride.
| Compound Name | 2-amino-6-borono-2-(2-methylpropyl)hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87173180 |
| Molecular Formula | C10H23BClNO4 |
| Molecular Weight | 267.56 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-amino-6-borono-2-(2-methylpropyl)hexanoic acid;hydrochloride |
| SMILES | CC(C)CC(N)(CCCCB(O)O)C(=O)O.Cl |
| InChI | InChI=1S/C10H22BNO4.ClH/c1-8(2)7-10(12,9(13)14)5-3-4-6-11(15)16;/h8,15-16H,3-7,12H2,1-2H3,(H,13,14);1H |
| InChIKey | JPDNLIUBIOUUAI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.56 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|