C8H15BN2O4 — CID 46849550
2-amino-6-borono-2-(cyanomethyl)hexanoic acid (PubChem CID 46849550) has the molecular formula C8H15BN2O4 and a molecular weight of 214.03 g/mol. Its IUPAC name is 2-amino-6-borono-2-(cyanomethyl)hexanoic acid.
| Compound Name | 2-amino-6-borono-2-(cyanomethyl)hexanoic acid |
|---|---|
| PubChem CID | 46849550 |
| Molecular Formula | C8H15BN2O4 |
| Molecular Weight | 214.03 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-amino-6-borono-2-(cyanomethyl)hexanoic acid |
| SMILES | N#CCC(N)(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C8H15BN2O4/c10-6-4-8(11,7(12)13)3-1-2-5-9(14)15/h14-15H,1-5,11H2,(H,12,13) |
| InChIKey | LRYKKEICDSJOQW-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.03 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|