C11H23BN2O6 — CID 54588659
(2R)-2-amino-6-borono-2-[2-[carboxymethyl(methyl)amino]ethyl]hexanoic acid (PubChem CID 54588659) has the molecular formula C11H23BN2O6 and a molecular weight of 290.12 g/mol. Its IUPAC name is (2R)-2-amino-6-borono-2-[2-[carboxymethyl(methyl)amino]ethyl]hexanoic acid.
| Compound Name | (2R)-2-amino-6-borono-2-[2-[carboxymethyl(methyl)amino]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 54588659 |
| Molecular Formula | C11H23BN2O6 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2R)-2-amino-6-borono-2-[2-[carboxymethyl(methyl)amino]ethyl]hexanoic acid |
| SMILES | CN(CC[C@](N)(CCCCB(O)O)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H23BN2O6/c1-14(8-9(15)16)7-5-11(13,10(17)18)4-2-3-6-12(19)20/h19-20H,2-8,13H2,1H3,(H,15,16)(H,17,18)/t11-/m1/s1 |
| InChIKey | XDFGAQLIZLVHQK-LLVKDONJSA-N |
| XLogP | -1.18 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|