C8H19BN4O4 — CID 155537312
(2R)-2-amino-6-borono-2-[(diaminomethylideneamino)methyl]hexanoic acid (PubChem CID 155537312) has the molecular formula C8H19BN4O4 and a molecular weight of 246.08 g/mol. Its IUPAC name is (2R)-2-amino-6-borono-2-[(diaminomethylideneamino)methyl]hexanoic acid.
| Compound Name | (2R)-2-amino-6-borono-2-[(diaminomethylideneamino)methyl]hexanoic acid |
|---|---|
| PubChem CID | 155537312 |
| Molecular Formula | C8H19BN4O4 |
| Molecular Weight | 246.08 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2R)-2-amino-6-borono-2-[(diaminomethylideneamino)methyl]hexanoic acid |
| SMILES | NC(N)=NC[C@](N)(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C8H19BN4O4/c10-7(11)13-5-8(12,6(14)15)3-1-2-4-9(16)17/h16-17H,1-5,12H2,(H,14,15)(H4,10,11,13)/t8-/m1/s1 |
| InChIKey | ICORRWRAEWOINO-MRVPVSSYSA-N |
| XLogP | -2.32 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.08 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|